About thiophene-2,4-diamine
thiophene-2,4-diamine (PubChem CID 19989301) has the molecular formula C4H6N2S
and a molecular weight of 114.17 g/mol. Its IUPAC name is thiophene-2,4-diamine.
Molecular Properties
| Compound Name | thiophene-2,4-diamine |
| PubChem CID | 19989301 |
| Molecular Formula | C4H6N2S |
| Molecular Weight | 114.17 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | thiophene-2,4-diamine |
| SMILES | Nc1csc(N)c1 |
| InChI | InChI=1S/C4H6N2S/c5-3-1-4(6)7-2-3/h1-2H,5-6H2 |
| InChIKey | YMEUGSSTDRDSCO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.17 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophene-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-2,4-diamine?
The IUPAC name of thiophene-2,4-diamine (CID 19989301) is thiophene-2,4-diamine.
What is the SMILES notation for thiophene-2,4-diamine?
The canonical SMILES for thiophene-2,4-diamine is Nc1csc(N)c1.
What is the InChIKey of thiophene-2,4-diamine?
The InChIKey is YMEUGSSTDRDSCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S/c5-3-1-4(6)7-2-3/h1-2H,5-6H2.
What are the key properties of thiophene-2,4-diamine?
thiophene-2,4-diamine has a molecular weight of 114.17 g/mol, XLogP of 0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-2,4-diamine is sourced from PubChem (CID 19989301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).