C13H10Cl2N4O — CID 19989327
3,7-dichloro-8-(1,2,4-triazol-1-ylmethoxymethyl)quinoline (PubChem CID 19989327) has the molecular formula C13H10Cl2N4O and a molecular weight of 309.16 g/mol. Its IUPAC name is 3,7-dichloro-8-(1,2,4-triazol-1-ylmethoxymethyl)quinoline.
| Compound Name | 3,7-dichloro-8-(1,2,4-triazol-1-ylmethoxymethyl)quinoline |
|---|---|
| PubChem CID | 19989327 |
| Molecular Formula | C13H10Cl2N4O |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3,7-dichloro-8-(1,2,4-triazol-1-ylmethoxymethyl)quinoline |
| SMILES | Clc1cnc2c(COCn3cncn3)c(Cl)ccc2c1 |
| InChI | InChI=1S/C13H10Cl2N4O/c14-10-3-9-1-2-12(15)11(13(9)17-4-10)5-20-8-19-7-16-6-18-19/h1-4,6-7H,5,8H2 |
| InChIKey | VCTCCRRWCBDCJK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |