About 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane
2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane (PubChem CID 19989508) has the molecular formula C18H20OS2
and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane |
| PubChem CID | 19989508 |
| Molecular Formula | C18H20OS2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane |
| SMILES | CC1(c2ccc(OCc3ccccc3)cc2)SCCCS1 |
| InChI | InChI=1S/C18H20OS2/c1-18(20-12-5-13-21-18)16-8-10-17(11-9-16)19-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3 |
| InChIKey | XIPVFPBNUVTCMR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane?
The IUPAC name of 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane (CID 19989508) is 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane.
What is the SMILES notation for 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane?
The canonical SMILES for 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane is CC1(c2ccc(OCc3ccccc3)cc2)SCCCS1.
What is the InChIKey of 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane?
The InChIKey is XIPVFPBNUVTCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20OS2/c1-18(20-12-5-13-21-18)16-8-10-17(11-9-16)19-14-15-6-3-2-4-7-15/h2-4,6-11H,5,12-14H2,1H3.
What are the key properties of 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane?
2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane has a molecular weight of 316.49 g/mol, XLogP of 5.31, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(4-phenylmethoxyphenyl)-1,3-dithiane is sourced from PubChem (CID 19989508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).