About 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane
2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane (PubChem CID 19989676) has the molecular formula C19H22O2S2
and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane |
| PubChem CID | 19989676 |
| Molecular Formula | C19H22O2S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane |
| SMILES | CC1(c2cccc(OCCOc3ccccc3)c2)SCCCS1 |
| InChI | InChI=1S/C19H22O2S2/c1-19(22-13-6-14-23-19)16-7-5-10-18(15-16)21-12-11-20-17-8-3-2-4-9-17/h2-5,7-10,15H,6,11-14H2,1H3 |
| InChIKey | OOUCFHJLSYDJJV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane?
The IUPAC name of 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane (CID 19989676) is 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane.
What is the SMILES notation for 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane?
The canonical SMILES for 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane is CC1(c2cccc(OCCOc3ccccc3)c2)SCCCS1.
What is the InChIKey of 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane?
The InChIKey is OOUCFHJLSYDJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O2S2/c1-19(22-13-6-14-23-19)16-7-5-10-18(15-16)21-12-11-20-17-8-3-2-4-9-17/h2-5,7-10,15H,6,11-14H2,1H3.
What are the key properties of 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane?
2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane has a molecular weight of 346.52 g/mol, XLogP of 5.19, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[3-(2-phenoxyethoxy)phenyl]-1,3-dithiane is sourced from PubChem (CID 19989676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).