About [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate
[1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate (PubChem CID 19989990) has the molecular formula C13H11Cl2N3OS
and a molecular weight of 328.22 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate.
Molecular Properties
| Compound Name | [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate |
| PubChem CID | 19989990 |
| Molecular Formula | C13H11Cl2N3OS |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate |
| SMILES | CCn1c(C)c(SC#N)c(=O)n1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H11Cl2N3OS/c1-3-17-8(2)12(20-7-16)13(19)18(17)9-4-5-10(14)11(15)6-9/h4-6H,3H2,1-2H3 |
| InChIKey | RTNPPSSFAKLVLC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate?
The IUPAC name of [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate (CID 19989990) is [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate.
What is the SMILES notation for [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate?
The canonical SMILES for [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate is CCn1c(C)c(SC#N)c(=O)n1-c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate?
The InChIKey is RTNPPSSFAKLVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11Cl2N3OS/c1-3-17-8(2)12(20-7-16)13(19)18(17)9-4-5-10(14)11(15)6-9/h4-6H,3H2,1-2H3.
What are the key properties of [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate?
[1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate has a molecular weight of 328.22 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,4-dichlorophenyl)-2-ethyl-3-methyl-5-oxopyrazol-4-yl] thiocyanate is sourced from PubChem (CID 19989990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).