About 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile
4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile (PubChem CID 19990452) has the molecular formula C10H4N4O3
and a molecular weight of 228.17 g/mol. Its IUPAC name is 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile |
| PubChem CID | 19990452 |
| Molecular Formula | C10H4N4O3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=O)c(=O)n(O)c2c1C#N |
| InChI | InChI=1S/C10H4N4O3/c11-3-5-1-2-7-8(6(5)4-12)14(17)10(16)9(15)13-7/h1-2,17H,(H,13,15) |
| InChIKey | LYMWFOZXYRBTCI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile?
The IUPAC name of 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile (CID 19990452) is 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile.
What is the SMILES notation for 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile?
The canonical SMILES for 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile is N#Cc1ccc2[nH]c(=O)c(=O)n(O)c2c1C#N.
What is the InChIKey of 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile?
The InChIKey is LYMWFOZXYRBTCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4N4O3/c11-3-5-1-2-7-8(6(5)4-12)14(17)10(16)9(15)13-7/h1-2,17H,(H,13,15).
What are the key properties of 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile?
4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile has a molecular weight of 228.17 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dioxo-1H-quinoxaline-5,6-dicarbonitrile is sourced from PubChem (CID 19990452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).