About (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone
(2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 19990481) has the molecular formula C20H11F3N2O2
and a molecular weight of 368.31 g/mol. Its IUPAC name is (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 19990481 |
| Molecular Formula | C20H11F3N2O2 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)c1ccc2oc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C20H11F3N2O2/c21-20(22,23)14-8-6-12(7-9-14)17(26)15-10-11-16-18(24-15)25-19(27-16)13-4-2-1-3-5-13/h1-11H |
| InChIKey | PRGWEOKYEFFFKB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone?
The IUPAC name of (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone (CID 19990481) is (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone is O=C(c1ccc(C(F)(F)F)cc1)c1ccc2oc(-c3ccccc3)nc2n1.
What is the InChIKey of (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone?
The InChIKey is PRGWEOKYEFFFKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11F3N2O2/c21-20(22,23)14-8-6-12(7-9-14)17(26)15-10-11-16-18(24-15)25-19(27-16)13-4-2-1-3-5-13/h1-11H.
What are the key properties of (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone?
(2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone has a molecular weight of 368.31 g/mol, XLogP of 5.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-[1,3]oxazolo[4,5-b]pyridin-5-yl)-[4-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 19990481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).