C29H33NO4S — CID 19990606
5-butyl-1,1-dioxo-2-(3-phenoxyphenyl)-3-(4-phenylbutyl)-1,3-thiazolidin-4-one (PubChem CID 19990606) has the molecular formula C29H33NO4S and a molecular weight of 491.65 g/mol. Its IUPAC name is 5-butyl-1,1-dioxo-2-(3-phenoxyphenyl)-3-(4-phenylbutyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-butyl-1,1-dioxo-2-(3-phenoxyphenyl)-3-(4-phenylbutyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 19990606 |
| Molecular Formula | C29H33NO4S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 5-butyl-1,1-dioxo-2-(3-phenoxyphenyl)-3-(4-phenylbutyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCC1C(=O)N(CCCCc2ccccc2)C(c2cccc(Oc3ccccc3)c2)S1(=O)=O |
| InChI | InChI=1S/C29H33NO4S/c1-2-3-20-27-28(31)30(21-11-10-15-23-13-6-4-7-14-23)29(35(27,32)33)24-16-12-19-26(22-24)34-25-17-8-5-9-18-25/h4-9,12-14,16-19,22,27,29H,2-3,10-11,15,20-21H2,1H3 |
| InChIKey | CBCWUXYFYYSGFB-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|