About 5-aminonaphthalen-1-ol;4-aminophenol
5-aminonaphthalen-1-ol;4-aminophenol (PubChem CID 19990694) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-aminonaphthalen-1-ol;4-aminophenol.
Molecular Properties
| Compound Name | 5-aminonaphthalen-1-ol;4-aminophenol |
| PubChem CID | 19990694 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-aminonaphthalen-1-ol;4-aminophenol |
| SMILES | Nc1ccc(O)cc1.Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C10H9NO.C6H7NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12;7-5-1-3-6(8)4-2-5/h1-6,12H,11H2;1-4,8H,7H2 |
| InChIKey | MTMREOHBTJSKOV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-aminonaphthalen-1-ol;4-aminophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminonaphthalen-1-ol;4-aminophenol?
The IUPAC name of 5-aminonaphthalen-1-ol;4-aminophenol (CID 19990694) is 5-aminonaphthalen-1-ol;4-aminophenol.
What is the SMILES notation for 5-aminonaphthalen-1-ol;4-aminophenol?
The canonical SMILES for 5-aminonaphthalen-1-ol;4-aminophenol is Nc1ccc(O)cc1.Nc1cccc2c(O)cccc12.
What is the InChIKey of 5-aminonaphthalen-1-ol;4-aminophenol?
The InChIKey is MTMREOHBTJSKOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C6H7NO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12;7-5-1-3-6(8)4-2-5/h1-6,12H,11H2;1-4,8H,7H2.
What are the key properties of 5-aminonaphthalen-1-ol;4-aminophenol?
5-aminonaphthalen-1-ol;4-aminophenol has a molecular weight of 268.32 g/mol, XLogP of 3.10, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminonaphthalen-1-ol;4-aminophenol is sourced from PubChem (CID 19990694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).