C6H12O6S — CID 19990727
2,3,4,5,6-pentahydroxyhexanethioic S-acid (PubChem CID 19990727) has the molecular formula C6H12O6S and a molecular weight of 212.22 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanethioic S-acid.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanethioic S-acid |
|---|---|
| PubChem CID | 19990727 |
| Molecular Formula | C6H12O6S |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanethioic S-acid |
| SMILES | O=C(S)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C6H12O6S/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13) |
| InChIKey | VIGXZAOSMWNPHO-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|