C7H6F8N6O10 — CID 19991080
1,3-bis(1,2-difluoro-1,2-dinitroethoxy)-2-N,2-N,2-N',2-N'-tetrafluoropropane-2,2-diamine (PubChem CID 19991080) has the molecular formula C7H6F8N6O10 and a molecular weight of 486.14 g/mol. Its IUPAC name is 1,3-bis(1,2-difluoro-1,2-dinitroethoxy)-2-N,2-N,2-N',2-N'-tetrafluoropropane-2,2-diamine.
| Compound Name | 1,3-bis(1,2-difluoro-1,2-dinitroethoxy)-2-N,2-N,2-N',2-N'-tetrafluoropropane-2,2-diamine |
|---|---|
| PubChem CID | 19991080 |
| Molecular Formula | C7H6F8N6O10 |
| Molecular Weight | 486.14 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | 1,3-bis(1,2-difluoro-1,2-dinitroethoxy)-2-N,2-N,2-N',2-N'-tetrafluoropropane-2,2-diamine |
| SMILES | O=[N+]([O-])C(F)C(F)(OCC(COC(F)(C(F)[N+](=O)[O-])[N+](=O)[O-])(N(F)F)N(F)F)[N+](=O)[O-] |
| InChI | InChI=1S/C7H6F8N6O10/c8-3(16(22)23)6(10,20(26)27)30-1-5(18(12)13,19(14)15)2-31-7(11,21(28)29)4(9)17(24)25/h3-4H,1-2H2 |
| InChIKey | VZINYLMFWIBJNS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 197.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.14 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|