About 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione
3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione (PubChem CID 19991266) has the molecular formula C29H48O6
and a molecular weight of 492.70 g/mol. Its IUPAC name is 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione.
Molecular Properties
| Compound Name | 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione |
| PubChem CID | 19991266 |
| Molecular Formula | C29H48O6 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione |
| SMILES | CCCCCCCCCC1CC(=O)CC(C2OC(=O)C(CCCCCCCCC)CC2=O)OC1=O |
| InChI | InChI=1S/C29H48O6/c1-3-5-7-9-11-13-15-17-22-19-24(30)21-26(34-28(22)32)27-25(31)20-23(29(33)35-27)18-16-14-12-10-8-6-4-2/h22-23,26-27H,3-21H2,1-2H3 |
| InChIKey | JWPNUCSAFNSVAH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione?
The IUPAC name of 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione (CID 19991266) is 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione.
What is the SMILES notation for 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione?
The canonical SMILES for 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione is CCCCCCCCCC1CC(=O)CC(C2OC(=O)C(CCCCCCCCC)CC2=O)OC1=O.
What is the InChIKey of 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione?
The InChIKey is JWPNUCSAFNSVAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H48O6/c1-3-5-7-9-11-13-15-17-22-19-24(30)21-26(34-28(22)32)27-25(31)20-23(29(33)35-27)18-16-14-12-10-8-6-4-2/h22-23,26-27H,3-21H2,1-2H3.
What are the key properties of 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione?
3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione has a molecular weight of 492.70 g/mol, XLogP of 6.66, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nonyl-7-(5-nonyl-3,6-dioxooxan-2-yl)oxepane-2,5-dione is sourced from PubChem (CID 19991266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).