About N,5-dimethyl-5H-1,2-thiazole-2-carboxamide
N,5-dimethyl-5H-1,2-thiazole-2-carboxamide (PubChem CID 19991344) has the molecular formula C6H10N2OS
and a molecular weight of 158.23 g/mol. Its IUPAC name is N,5-dimethyl-5H-1,2-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N,5-dimethyl-5H-1,2-thiazole-2-carboxamide |
| PubChem CID | 19991344 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | N,5-dimethyl-5H-1,2-thiazole-2-carboxamide |
| SMILES | CNC(=O)N1C=CC(C)S1 |
| InChI | InChI=1S/C6H10N2OS/c1-5-3-4-8(10-5)6(9)7-2/h3-5H,1-2H3,(H,7,9) |
| InChIKey | CZRWUMKGLWTCJJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,5-dimethyl-5H-1,2-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-5H-1,2-thiazole-2-carboxamide?
The IUPAC name of N,5-dimethyl-5H-1,2-thiazole-2-carboxamide (CID 19991344) is N,5-dimethyl-5H-1,2-thiazole-2-carboxamide.
What is the SMILES notation for N,5-dimethyl-5H-1,2-thiazole-2-carboxamide?
The canonical SMILES for N,5-dimethyl-5H-1,2-thiazole-2-carboxamide is CNC(=O)N1C=CC(C)S1.
What is the InChIKey of N,5-dimethyl-5H-1,2-thiazole-2-carboxamide?
The InChIKey is CZRWUMKGLWTCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2OS/c1-5-3-4-8(10-5)6(9)7-2/h3-5H,1-2H3,(H,7,9).
What are the key properties of N,5-dimethyl-5H-1,2-thiazole-2-carboxamide?
N,5-dimethyl-5H-1,2-thiazole-2-carboxamide has a molecular weight of 158.23 g/mol, XLogP of 1.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-5H-1,2-thiazole-2-carboxamide is sourced from PubChem (CID 19991344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).