About N-propyl-5H-1,2-thiazole-2-carboxamide
N-propyl-5H-1,2-thiazole-2-carboxamide (PubChem CID 19991365) has the molecular formula C7H12N2OS
and a molecular weight of 172.25 g/mol. Its IUPAC name is N-propyl-5H-1,2-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-propyl-5H-1,2-thiazole-2-carboxamide |
| PubChem CID | 19991365 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | N-propyl-5H-1,2-thiazole-2-carboxamide |
| SMILES | CCCNC(=O)N1C=CCS1 |
| InChI | InChI=1S/C7H12N2OS/c1-2-4-8-7(10)9-5-3-6-11-9/h3,5H,2,4,6H2,1H3,(H,8,10) |
| InChIKey | PZDDBQPIJACAET-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-5H-1,2-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-5H-1,2-thiazole-2-carboxamide?
The IUPAC name of N-propyl-5H-1,2-thiazole-2-carboxamide (CID 19991365) is N-propyl-5H-1,2-thiazole-2-carboxamide.
What is the SMILES notation for N-propyl-5H-1,2-thiazole-2-carboxamide?
The canonical SMILES for N-propyl-5H-1,2-thiazole-2-carboxamide is CCCNC(=O)N1C=CCS1.
What is the InChIKey of N-propyl-5H-1,2-thiazole-2-carboxamide?
The InChIKey is PZDDBQPIJACAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2OS/c1-2-4-8-7(10)9-5-3-6-11-9/h3,5H,2,4,6H2,1H3,(H,8,10).
What are the key properties of N-propyl-5H-1,2-thiazole-2-carboxamide?
N-propyl-5H-1,2-thiazole-2-carboxamide has a molecular weight of 172.25 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-5H-1,2-thiazole-2-carboxamide is sourced from PubChem (CID 19991365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).