C27H23N5O4 — CID 19991555
methyl 2-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-5-(2H-tetrazol-5-ylmethyl)benzoate (PubChem CID 19991555) has the molecular formula C27H23N5O4 and a molecular weight of 481.51 g/mol. Its IUPAC name is methyl 2-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-5-(2H-tetrazol-5-ylmethyl)benzoate.
| Compound Name | methyl 2-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-5-(2H-tetrazol-5-ylmethyl)benzoate |
|---|---|
| PubChem CID | 19991555 |
| Molecular Formula | C27H23N5O4 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | methyl 2-[[4-(quinolin-2-ylmethoxy)phenyl]methoxy]-5-(2H-tetrazol-5-ylmethyl)benzoate |
| SMILES | COC(=O)c1cc(Cc2nn[nH]n2)ccc1OCc1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C27H23N5O4/c1-34-27(33)23-14-19(15-26-29-31-32-30-26)8-13-25(23)36-16-18-6-11-22(12-7-18)35-17-21-10-9-20-4-2-3-5-24(20)28-21/h2-14H,15-17H2,1H3,(H,29,30,31,32) |
| InChIKey | XQEUSPAENFMSAS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |