About [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate
[4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 19991688) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate |
| PubChem CID | 19991688 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C(OC(=O)C(=C)C)C(C)(C)C |
| InChI | InChI=1S/C15H24O4/c1-9(2)13(16)18-11(5)12(15(6,7)8)19-14(17)10(3)4/h11-12H,1,3H2,2,4-8H3 |
| InChIKey | JYWGMWFIRXJGBH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate?
The IUPAC name of [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate (CID 19991688) is [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate.
What is the SMILES notation for [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate?
The canonical SMILES for [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate is C=C(C)C(=O)OC(C)C(OC(=O)C(=C)C)C(C)(C)C.
What is the InChIKey of [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate?
The InChIKey is JYWGMWFIRXJGBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-9(2)13(16)18-11(5)12(15(6,7)8)19-14(17)10(3)4/h11-12H,1,3H2,2,4-8H3.
What are the key properties of [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate?
[4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate has a molecular weight of 268.35 g/mol, XLogP of 3.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-3-(2-methylprop-2-enoyloxy)pentan-2-yl] 2-methylprop-2-enoate is sourced from PubChem (CID 19991688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).