C10H13N — CID 19991719
2,3,9,9a-tetrahydro-1H-3-benzazepine (PubChem CID 19991719) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,3,9,9a-tetrahydro-1H-3-benzazepine.
| Compound Name | 2,3,9,9a-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 19991719 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 2,3,9,9a-tetrahydro-1H-3-benzazepine |
| SMILES | C1=CCC2CCNC=CC2=C1 |
| InChI | InChI=1S/C10H13N/c1-2-4-10-6-8-11-7-5-9(10)3-1/h1-3,5,7,10-11H,4,6,8H2 |
| InChIKey | KOELYLNEILGAQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |