C21H36ClN5 — CID 19991761
2-chloro-4,6-bis(2,2,6,6-tetramethylpiperidin-1-yl)-1,3,5-triazine (PubChem CID 19991761) has the molecular formula C21H36ClN5 and a molecular weight of 394.01 g/mol. Its IUPAC name is 2-chloro-4,6-bis(2,2,6,6-tetramethylpiperidin-1-yl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(2,2,6,6-tetramethylpiperidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 19991761 |
| Molecular Formula | C21H36ClN5 |
| Molecular Weight | 394.01 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | 2-chloro-4,6-bis(2,2,6,6-tetramethylpiperidin-1-yl)-1,3,5-triazine |
| SMILES | CC1(C)CCCC(C)(C)N1c1nc(Cl)nc(N2C(C)(C)CCCC2(C)C)n1 |
| InChI | InChI=1S/C21H36ClN5/c1-18(2)11-9-12-19(3,4)26(18)16-23-15(22)24-17(25-16)27-20(5,6)13-10-14-21(27,7)8/h9-14H2,1-8H3 |
| InChIKey | FIFCPJBRZRWPHH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.01 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |