C44H84N8O — CID 19991762
2-N,4-N-dibutyl-6-(4-hexoxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 19991762) has the molecular formula C44H84N8O and a molecular weight of 741.21 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-(4-hexoxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-6-(4-hexoxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 19991762 |
| Molecular Formula | C44H84N8O |
| Molecular Weight | 741.21 g/mol |
| Exact Mass | 740.68 |
| IUPAC Name | 2-N,4-N-dibutyl-6-(4-hexoxy-2,2,6,6-tetramethylpiperidin-1-yl)-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCCOC1CC(C)(C)N(c2nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)n2)C(C)(C)C1 |
| InChI | InChI=1S/C44H84N8O/c1-16-19-22-23-26-53-35-31-43(12,13)52(44(14,15)32-35)38-46-36(50(24-20-17-2)33-27-39(4,5)48-40(6,7)28-33)45-37(47-38)51(25-21-18-3)34-29-41(8,9)49-42(10,11)30-34/h33-35,48-49H,16-32H2,1-15H3 |
| InChIKey | NMDHXIYCIOYOSQ-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.21 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|