C15H30N2O — CID 19991763
3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexan-2-one (PubChem CID 19991763) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexan-2-one.
| Compound Name | 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexan-2-one |
|---|---|
| PubChem CID | 19991763 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexan-2-one |
| SMILES | CCCC(NC1CC(C)(C)NC(C)(C)C1)C(C)=O |
| InChI | InChI=1S/C15H30N2O/c1-7-8-13(11(2)18)16-12-9-14(3,4)17-15(5,6)10-12/h12-13,16-17H,7-10H2,1-6H3 |
| InChIKey | JNFPQFHNFBCGDJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |