About 1-ethoxy-2-methylhexane
1-ethoxy-2-methylhexane (PubChem CID 19991834) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is 1-ethoxy-2-methylhexane.
Molecular Properties
| Compound Name | 1-ethoxy-2-methylhexane |
| PubChem CID | 19991834 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | 1-ethoxy-2-methylhexane |
| SMILES | CCCCC(C)COCC |
| InChI | InChI=1S/C9H20O/c1-4-6-7-9(3)8-10-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | UBJYXOHABMNKFO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethoxy-2-methylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-2-methylhexane?
The IUPAC name of 1-ethoxy-2-methylhexane (CID 19991834) is 1-ethoxy-2-methylhexane.
What is the SMILES notation for 1-ethoxy-2-methylhexane?
The canonical SMILES for 1-ethoxy-2-methylhexane is CCCCC(C)COCC.
What is the InChIKey of 1-ethoxy-2-methylhexane?
The InChIKey is UBJYXOHABMNKFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O/c1-4-6-7-9(3)8-10-5-2/h9H,4-8H2,1-3H3.
What are the key properties of 1-ethoxy-2-methylhexane?
1-ethoxy-2-methylhexane has a molecular weight of 144.26 g/mol, XLogP of 2.85, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-2-methylhexane is sourced from PubChem (CID 19991834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).