About 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one
5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one (PubChem CID 19992120) has the molecular formula C18H25NO3S
and a molecular weight of 335.47 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one.
Molecular Properties
| Compound Name | 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one |
| PubChem CID | 19992120 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one |
| SMILES | Cc1ccccc1CC1CCCCC12CC(=O)NCCS2(=O)=O |
| InChI | InChI=1S/C18H25NO3S/c1-14-6-2-3-7-15(14)12-16-8-4-5-9-18(16)13-17(20)19-10-11-23(18,21)22/h2-3,6-7,16H,4-5,8-13H2,1H3,(H,19,20) |
| InChIKey | PXLBVESMCLCIMW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one?
The IUPAC name of 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one (CID 19992120) is 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one.
What is the SMILES notation for 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one?
The canonical SMILES for 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one is Cc1ccccc1CC1CCCCC12CC(=O)NCCS2(=O)=O.
What is the InChIKey of 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one?
The InChIKey is PXLBVESMCLCIMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO3S/c1-14-6-2-3-7-15(14)12-16-8-4-5-9-18(16)13-17(20)19-10-11-23(18,21)22/h2-3,6-7,16H,4-5,8-13H2,1H3,(H,19,20).
What are the key properties of 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one?
5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one has a molecular weight of 335.47 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methylphenyl)methyl]-7,7-dioxo-7λ6-thia-10-azaspiro[5.6]dodecan-11-one is sourced from PubChem (CID 19992120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).