About 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride
9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride (PubChem CID 19992210) has the molecular formula C13H20Cl2F2N6O
and a molecular weight of 385.25 g/mol. Its IUPAC name is 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride.
Molecular Properties
| Compound Name | 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride |
| PubChem CID | 19992210 |
| Molecular Formula | C13H20Cl2F2N6O |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride |
| SMILES | COc1nc(N2CCNCC2)c2ncn(CC(C)(F)F)c2n1.Cl.Cl |
| InChI | InChI=1S/C13H18F2N6O.2ClH/c1-13(14,15)7-21-8-17-9-10(20-5-3-16-4-6-20)18-12(22-2)19-11(9)21;;/h8,16H,3-7H2,1-2H3;2*1H |
| InChIKey | XSIJFXASJNCHOY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride?
The IUPAC name of 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride (CID 19992210) is 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride.
What is the SMILES notation for 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride?
The canonical SMILES for 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride is COc1nc(N2CCNCC2)c2ncn(CC(C)(F)F)c2n1.Cl.Cl.
What is the InChIKey of 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride?
The InChIKey is XSIJFXASJNCHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F2N6O.2ClH/c1-13(14,15)7-21-8-17-9-10(20-5-3-16-4-6-20)18-12(22-2)19-11(9)21;;/h8,16H,3-7H2,1-2H3;2*1H.
What are the key properties of 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride?
9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride has a molecular weight of 385.25 g/mol, XLogP of 1.74, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,2-difluoropropyl)-2-methoxy-6-piperazin-1-ylpurine;dihydrochloride is sourced from PubChem (CID 19992210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).