About 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide
4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide (PubChem CID 19992279) has the molecular formula C24H28F4N2O2
and a molecular weight of 452.49 g/mol. Its IUPAC name is 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide |
| PubChem CID | 19992279 |
| Molecular Formula | C24H28F4N2O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCN1CCC(C(O)(c2ccc(F)c(F)c2)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H28F4N2O2/c1-29(2)23(31)4-3-11-30-12-9-16(10-13-30)24(32,17-5-7-19(25)21(27)14-17)18-6-8-20(26)22(28)15-18/h5-8,14-16,32H,3-4,9-13H2,1-2H3 |
| InChIKey | RKLFYQMBSVWVOK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide?
The IUPAC name of 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide (CID 19992279) is 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide.
What is the SMILES notation for 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide?
The canonical SMILES for 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide is CN(C)C(=O)CCCN1CCC(C(O)(c2ccc(F)c(F)c2)c2ccc(F)c(F)c2)CC1.
What is the InChIKey of 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide?
The InChIKey is RKLFYQMBSVWVOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28F4N2O2/c1-29(2)23(31)4-3-11-30-12-9-16(10-13-30)24(32,17-5-7-19(25)21(27)14-17)18-6-8-20(26)22(28)15-18/h5-8,14-16,32H,3-4,9-13H2,1-2H3.
What are the key properties of 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide?
4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide has a molecular weight of 452.49 g/mol, XLogP of 4.06, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[bis(3,4-difluorophenyl)-hydroxymethyl]piperidin-1-yl]-N,N-dimethylbutanamide is sourced from PubChem (CID 19992279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).