About 4-(2,2-diphenylpiperidin-1-yl)butanamide
4-(2,2-diphenylpiperidin-1-yl)butanamide (PubChem CID 19992345) has the molecular formula C21H26N2O
and a molecular weight of 322.45 g/mol. Its IUPAC name is 4-(2,2-diphenylpiperidin-1-yl)butanamide.
Molecular Properties
| Compound Name | 4-(2,2-diphenylpiperidin-1-yl)butanamide |
| PubChem CID | 19992345 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 4-(2,2-diphenylpiperidin-1-yl)butanamide |
| SMILES | NC(=O)CCCN1CCCCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c22-20(24)14-9-17-23-16-8-7-15-21(23,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-6,10-13H,7-9,14-17H2,(H2,22,24) |
| InChIKey | QUVQCWHYEFQCAI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,2-diphenylpiperidin-1-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-diphenylpiperidin-1-yl)butanamide?
The IUPAC name of 4-(2,2-diphenylpiperidin-1-yl)butanamide (CID 19992345) is 4-(2,2-diphenylpiperidin-1-yl)butanamide.
What is the SMILES notation for 4-(2,2-diphenylpiperidin-1-yl)butanamide?
The canonical SMILES for 4-(2,2-diphenylpiperidin-1-yl)butanamide is NC(=O)CCCN1CCCCC1(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(2,2-diphenylpiperidin-1-yl)butanamide?
The InChIKey is QUVQCWHYEFQCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N2O/c22-20(24)14-9-17-23-16-8-7-15-21(23,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-6,10-13H,7-9,14-17H2,(H2,22,24).
What are the key properties of 4-(2,2-diphenylpiperidin-1-yl)butanamide?
4-(2,2-diphenylpiperidin-1-yl)butanamide has a molecular weight of 322.45 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-diphenylpiperidin-1-yl)butanamide is sourced from PubChem (CID 19992345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).