C16H12ClN3O2 — CID 19992373
2-(2-chloro-4-pyridinyl)-7,7-dimethyl-5H-pyrrolo[3,2-f][1,3]benzoxazol-6-one (PubChem CID 19992373) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-(2-chloro-4-pyridinyl)-7,7-dimethyl-5H-pyrrolo[3,2-f][1,3]benzoxazol-6-one.
| Compound Name | 2-(2-chloro-4-pyridinyl)-7,7-dimethyl-5H-pyrrolo[3,2-f][1,3]benzoxazol-6-one |
|---|---|
| PubChem CID | 19992373 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-(2-chloro-4-pyridinyl)-7,7-dimethyl-5H-pyrrolo[3,2-f][1,3]benzoxazol-6-one |
| SMILES | CC1(C)C(=O)Nc2cc3oc(-c4ccnc(Cl)c4)nc3cc21 |
| InChI | InChI=1S/C16H12ClN3O2/c1-16(2)9-6-11-12(7-10(9)20-15(16)21)22-14(19-11)8-3-4-18-13(17)5-8/h3-7H,1-2H3,(H,20,21) |
| InChIKey | XIBUGDAMYCESSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|