About 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride
1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride (PubChem CID 19993281) has the molecular formula C20H22F5OS-5
and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride.
Molecular Properties
| Compound Name | 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride |
| PubChem CID | 19993281 |
| Molecular Formula | C20H22F5OS-5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride |
| SMILES | CCCCCCOc1ccc(C#CSc2ccccc2)cc1.[F-].[F-].[F-].[F-].[F-] |
| InChI | InChI=1S/C20H22OS.5FH/c1-2-3-4-8-16-21-19-13-11-18(12-14-19)15-17-22-20-9-6-5-7-10-20;;;;;/h5-7,9-14H,2-4,8,16H2,1H3;5*1H/p-5 |
| InChIKey | QMFMWCDBHFIBON-UHFFFAOYSA-I |
| XLogP | -9.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | -9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride?
The IUPAC name of 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride (CID 19993281) is 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride.
What is the SMILES notation for 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride?
The canonical SMILES for 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride is CCCCCCOc1ccc(C#CSc2ccccc2)cc1.[F-].[F-].[F-].[F-].[F-].
What is the InChIKey of 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride?
The InChIKey is QMFMWCDBHFIBON-UHFFFAOYSA-I. The full InChI is InChI=1S/C20H22OS.5FH/c1-2-3-4-8-16-21-19-13-11-18(12-14-19)15-17-22-20-9-6-5-7-10-20;;;;;/h5-7,9-14H,2-4,8,16H2,1H3;5*1H/p-5.
What are the key properties of 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride?
1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride has a molecular weight of 405.45 g/mol, XLogP of -9.23, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexoxy-4-(2-phenylsulfanylethynyl)benzene pentafluoride is sourced from PubChem (CID 19993281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).