About butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium
butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium (PubChem CID 19993385) has the molecular formula C38H60BN
and a molecular weight of 541.72 g/mol. Its IUPAC name is butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium.
Molecular Properties
| Compound Name | butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium |
| PubChem CID | 19993385 |
| Molecular Formula | C38H60BN |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.48 |
| IUPAC Name | butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium |
| SMILES | CCCC[B-](c1ccccc1C(C)(C)C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C.C[N+](C)(C)C |
| InChI | InChI=1S/C34H48B.C4H12N/c1-11-12-25-35(29-22-16-13-19-26(29)32(2,3)4,30-23-17-14-20-27(30)33(5,6)7)31-24-18-15-21-28(31)34(8,9)10;1-5(2,3)4/h13-24H,11-12,25H2,1-10H3;1-4H3/q-1;+1 |
| InChIKey | PDXMAONHJAXNIT-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium?
The IUPAC name of butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium (CID 19993385) is butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium.
What is the SMILES notation for butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium?
The canonical SMILES for butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium is CCCC[B-](c1ccccc1C(C)(C)C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C.C[N+](C)(C)C.
What is the InChIKey of butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium?
The InChIKey is PDXMAONHJAXNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H48B.C4H12N/c1-11-12-25-35(29-22-16-13-19-26(29)32(2,3)4,30-23-17-14-20-27(30)33(5,6)7)31-24-18-15-21-28(31)34(8,9)10;1-5(2,3)4/h13-24H,11-12,25H2,1-10H3;1-4H3/q-1;+1.
What are the key properties of butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium?
butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium has a molecular weight of 541.72 g/mol, XLogP of 8.17, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-tris(2-tert-butylphenyl)boranuide;tetramethylazanium is sourced from PubChem (CID 19993385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).