About tris(propan-2-ol);prop-2-enoic acid;titanium
tris(propan-2-ol);prop-2-enoic acid;titanium (PubChem CID 19993431) has the molecular formula C12H28O5Ti
and a molecular weight of 300.22 g/mol. Its IUPAC name is tris(propan-2-ol);prop-2-enoic acid;titanium.
Molecular Properties
| Compound Name | tris(propan-2-ol);prop-2-enoic acid;titanium |
| PubChem CID | 19993431 |
| Molecular Formula | C12H28O5Ti |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | tris(propan-2-ol);prop-2-enoic acid;titanium |
| SMILES | C=CC(=O)O.CC(C)O.CC(C)O.CC(C)O.[Ti] |
| InChI | InChI=1S/C3H4O2.3C3H8O.Ti/c1-2-3(4)5;3*1-3(2)4;/h2H,1H2,(H,4,5);3*3-4H,1-2H3; |
| InChIKey | QCUGMZDNIUDREH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tris(propan-2-ol);prop-2-enoic acid;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(propan-2-ol);prop-2-enoic acid;titanium?
The IUPAC name of tris(propan-2-ol);prop-2-enoic acid;titanium (CID 19993431) is tris(propan-2-ol);prop-2-enoic acid;titanium.
What is the SMILES notation for tris(propan-2-ol);prop-2-enoic acid;titanium?
The canonical SMILES for tris(propan-2-ol);prop-2-enoic acid;titanium is C=CC(=O)O.CC(C)O.CC(C)O.CC(C)O.[Ti].
What is the InChIKey of tris(propan-2-ol);prop-2-enoic acid;titanium?
The InChIKey is QCUGMZDNIUDREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.3C3H8O.Ti/c1-2-3(4)5;3*1-3(2)4;/h2H,1H2,(H,4,5);3*3-4H,1-2H3;.
What are the key properties of tris(propan-2-ol);prop-2-enoic acid;titanium?
tris(propan-2-ol);prop-2-enoic acid;titanium has a molecular weight of 300.22 g/mol, XLogP of 1.42, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris(propan-2-ol);prop-2-enoic acid;titanium is sourced from PubChem (CID 19993431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).