C13H15F3 — CID 19994176
5-ethenyl-5-methyl-1-(3,4,4-trifluorobut-3-enyl)cyclohexa-1,3-diene (PubChem CID 19994176) has the molecular formula C13H15F3 and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-ethenyl-5-methyl-1-(3,4,4-trifluorobut-3-enyl)cyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-5-methyl-1-(3,4,4-trifluorobut-3-enyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 19994176 |
| Molecular Formula | C13H15F3 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-ethenyl-5-methyl-1-(3,4,4-trifluorobut-3-enyl)cyclohexa-1,3-diene |
| SMILES | C=CC1(C)C=CC=C(CCC(F)=C(F)F)C1 |
| InChI | InChI=1S/C13H15F3/c1-3-13(2)8-4-5-10(9-13)6-7-11(14)12(15)16/h3-5,8H,1,6-7,9H2,2H3 |
| InChIKey | OARXKCWCKOFEGA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|