About 1,1,2-trifluoro-6-methylhepta-1,6-diene
1,1,2-trifluoro-6-methylhepta-1,6-diene (PubChem CID 19994177) has the molecular formula C8H11F3
and a molecular weight of 164.17 g/mol. Its IUPAC name is 1,1,2-trifluoro-6-methylhepta-1,6-diene.
Molecular Properties
| Compound Name | 1,1,2-trifluoro-6-methylhepta-1,6-diene |
| PubChem CID | 19994177 |
| Molecular Formula | C8H11F3 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1,1,2-trifluoro-6-methylhepta-1,6-diene |
| SMILES | C=C(C)CCCC(F)=C(F)F |
| InChI | InChI=1S/C8H11F3/c1-6(2)4-3-5-7(9)8(10)11/h1,3-5H2,2H3 |
| InChIKey | JTSBUXWIUIKFOM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2-trifluoro-6-methylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluoro-6-methylhepta-1,6-diene?
The IUPAC name of 1,1,2-trifluoro-6-methylhepta-1,6-diene (CID 19994177) is 1,1,2-trifluoro-6-methylhepta-1,6-diene.
What is the SMILES notation for 1,1,2-trifluoro-6-methylhepta-1,6-diene?
The canonical SMILES for 1,1,2-trifluoro-6-methylhepta-1,6-diene is C=C(C)CCCC(F)=C(F)F.
What is the InChIKey of 1,1,2-trifluoro-6-methylhepta-1,6-diene?
The InChIKey is JTSBUXWIUIKFOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3/c1-6(2)4-3-5-7(9)8(10)11/h1,3-5H2,2H3.
What are the key properties of 1,1,2-trifluoro-6-methylhepta-1,6-diene?
1,1,2-trifluoro-6-methylhepta-1,6-diene has a molecular weight of 164.17 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluoro-6-methylhepta-1,6-diene is sourced from PubChem (CID 19994177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).