About 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine
6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine (PubChem CID 19994618) has the molecular formula C17H16Br2N2
and a molecular weight of 408.14 g/mol. Its IUPAC name is 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine |
| PubChem CID | 19994618 |
| Molecular Formula | C17H16Br2N2 |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine |
| SMILES | CCc1ccccc1CCc1nccn2c(Br)cc(Br)c12 |
| InChI | InChI=1S/C17H16Br2N2/c1-2-12-5-3-4-6-13(12)7-8-15-17-14(18)11-16(19)21(17)10-9-20-15/h3-6,9-11H,2,7-8H2,1H3 |
| InChIKey | LYOIPLQTNBOMOW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine?
The IUPAC name of 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine (CID 19994618) is 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine?
The canonical SMILES for 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine is CCc1ccccc1CCc1nccn2c(Br)cc(Br)c12.
What is the InChIKey of 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine?
The InChIKey is LYOIPLQTNBOMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Br2N2/c1-2-12-5-3-4-6-13(12)7-8-15-17-14(18)11-16(19)21(17)10-9-20-15/h3-6,9-11H,2,7-8H2,1H3.
What are the key properties of 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine?
6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine has a molecular weight of 408.14 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dibromo-1-[2-(2-ethylphenyl)ethyl]pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 19994618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).