About (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide
(2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide (PubChem CID 19994785) has the molecular formula C27H20BrN2OP
and a molecular weight of 499.35 g/mol. Its IUPAC name is (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide |
| PubChem CID | 19994785 |
| Molecular Formula | C27H20BrN2OP |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide |
| SMILES | N#Cc1nc2ccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2o1.[Br-] |
| InChI | InChI=1S/C27H20N2OP.BrH/c28-19-27-29-25-17-16-21(18-26(25)30-27)20-31(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24;/h1-18H,20H2;1H/q+1;/p-1 |
| InChIKey | SLLKGYDHCUVGNF-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide?
The IUPAC name of (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide (CID 19994785) is (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide.
What is the SMILES notation for (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide?
The canonical SMILES for (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide is N#Cc1nc2ccc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)cc2o1.[Br-].
What is the InChIKey of (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide?
The InChIKey is SLLKGYDHCUVGNF-UHFFFAOYSA-M. The full InChI is InChI=1S/C27H20N2OP.BrH/c28-19-27-29-25-17-16-21(18-26(25)30-27)20-31(22-10-4-1-5-11-22,23-12-6-2-7-13-23)24-14-8-3-9-15-24;/h1-18H,20H2;1H/q+1;/p-1.
What are the key properties of (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide?
(2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide has a molecular weight of 499.35 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyano-1,3-benzoxazol-6-yl)methyl-triphenylphosphanium bromide is sourced from PubChem (CID 19994785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).