About 3-methoxy-N,N-dimethylpiperidin-4-amine
3-methoxy-N,N-dimethylpiperidin-4-amine (PubChem CID 19994869) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethylpiperidin-4-amine.
Molecular Properties
| Compound Name | 3-methoxy-N,N-dimethylpiperidin-4-amine |
| PubChem CID | 19994869 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 3-methoxy-N,N-dimethylpiperidin-4-amine |
| SMILES | COC1CNCCC1N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-10(2)7-4-5-9-6-8(7)11-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | AJTAVLFVXILWDV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-N,N-dimethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-dimethylpiperidin-4-amine?
The IUPAC name of 3-methoxy-N,N-dimethylpiperidin-4-amine (CID 19994869) is 3-methoxy-N,N-dimethylpiperidin-4-amine.
What is the SMILES notation for 3-methoxy-N,N-dimethylpiperidin-4-amine?
The canonical SMILES for 3-methoxy-N,N-dimethylpiperidin-4-amine is COC1CNCCC1N(C)C.
What is the InChIKey of 3-methoxy-N,N-dimethylpiperidin-4-amine?
The InChIKey is AJTAVLFVXILWDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-10(2)7-4-5-9-6-8(7)11-3/h7-9H,4-6H2,1-3H3.
What are the key properties of 3-methoxy-N,N-dimethylpiperidin-4-amine?
3-methoxy-N,N-dimethylpiperidin-4-amine has a molecular weight of 158.24 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-dimethylpiperidin-4-amine is sourced from PubChem (CID 19994869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).