C13H24N2O3 — CID 19995107
4-amino-4-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)butanoic acid (PubChem CID 19995107) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-amino-4-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)butanoic acid.
| Compound Name | 4-amino-4-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)butanoic acid |
|---|---|
| PubChem CID | 19995107 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-amino-4-oxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)butanoic acid |
| SMILES | CC1(C)CC(C(CC(N)=O)C(=O)O)CC(C)(C)N1 |
| InChI | InChI=1S/C13H24N2O3/c1-12(2)6-8(7-13(3,4)15-12)9(11(17)18)5-10(14)16/h8-9,15H,5-7H2,1-4H3,(H2,14,16)(H,17,18) |
| InChIKey | VNTHSMPYKTYSFW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |