About triethyl(3-methylbuta-1,3-dien-2-yl)silane
triethyl(3-methylbuta-1,3-dien-2-yl)silane (PubChem CID 19995268) has the molecular formula C11H22Si
and a molecular weight of 182.38 g/mol. Its IUPAC name is triethyl(3-methylbuta-1,3-dien-2-yl)silane.
Molecular Properties
| Compound Name | triethyl(3-methylbuta-1,3-dien-2-yl)silane |
| PubChem CID | 19995268 |
| Molecular Formula | C11H22Si |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | triethyl(3-methylbuta-1,3-dien-2-yl)silane |
| SMILES | C=C(C)C(=C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H22Si/c1-7-12(8-2,9-3)11(6)10(4)5/h4,6-9H2,1-3,5H3 |
| InChIKey | LLUNXPNZRWGGJO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl(3-methylbuta-1,3-dien-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl(3-methylbuta-1,3-dien-2-yl)silane?
The IUPAC name of triethyl(3-methylbuta-1,3-dien-2-yl)silane (CID 19995268) is triethyl(3-methylbuta-1,3-dien-2-yl)silane.
What is the SMILES notation for triethyl(3-methylbuta-1,3-dien-2-yl)silane?
The canonical SMILES for triethyl(3-methylbuta-1,3-dien-2-yl)silane is C=C(C)C(=C)[Si](CC)(CC)CC.
What is the InChIKey of triethyl(3-methylbuta-1,3-dien-2-yl)silane?
The InChIKey is LLUNXPNZRWGGJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22Si/c1-7-12(8-2,9-3)11(6)10(4)5/h4,6-9H2,1-3,5H3.
What are the key properties of triethyl(3-methylbuta-1,3-dien-2-yl)silane?
triethyl(3-methylbuta-1,3-dien-2-yl)silane has a molecular weight of 182.38 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl(3-methylbuta-1,3-dien-2-yl)silane is sourced from PubChem (CID 19995268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).