About 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride
3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride (PubChem CID 19995319) has the molecular formula C20H11Cl3F4O3
and a molecular weight of 481.66 g/mol. Its IUPAC name is 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride.
Molecular Properties
| Compound Name | 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride |
| PubChem CID | 19995319 |
| Molecular Formula | C20H11Cl3F4O3 |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride |
| SMILES | O=C(Cl)CCOc1ccc2ccc(Oc3c(Cl)cc(C(F)(F)F)c(F)c3Cl)cc2c1 |
| InChI | InChI=1S/C20H11Cl3F4O3/c21-15-9-14(20(25,26)27)18(24)17(23)19(15)30-13-4-2-10-1-3-12(7-11(10)8-13)29-6-5-16(22)28/h1-4,7-9H,5-6H2 |
| InChIKey | DLPGXSOUMLLBHQ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride?
The IUPAC name of 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride (CID 19995319) is 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride.
What is the SMILES notation for 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride?
The canonical SMILES for 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride is O=C(Cl)CCOc1ccc2ccc(Oc3c(Cl)cc(C(F)(F)F)c(F)c3Cl)cc2c1.
What is the InChIKey of 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride?
The InChIKey is DLPGXSOUMLLBHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Cl3F4O3/c21-15-9-14(20(25,26)27)18(24)17(23)19(15)30-13-4-2-10-1-3-12(7-11(10)8-13)29-6-5-16(22)28/h1-4,7-9H,5-6H2.
What are the key properties of 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride?
3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride has a molecular weight of 481.66 g/mol, XLogP of 7.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[7-[2,6-dichloro-3-fluoro-4-(trifluoromethyl)phenoxy]naphthalen-2-yl]oxypropanoyl chloride is sourced from PubChem (CID 19995319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).