About dizinc;benzoate;borate
dizinc;benzoate;borate (PubChem CID 19995354) has the molecular formula C7H5BO5Zn2
and a molecular weight of 310.70 g/mol. Its IUPAC name is dizinc;benzoate;borate.
Molecular Properties
| Compound Name | dizinc;benzoate;borate |
| PubChem CID | 19995354 |
| Molecular Formula | C7H5BO5Zn2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 307.88 |
| IUPAC Name | dizinc;benzoate;borate |
| SMILES | O=C([O-])c1ccccc1.[O-]B([O-])[O-].[Zn+2].[Zn+2] |
| InChI | InChI=1S/C7H6O2.BO3.2Zn/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;;/h1-5H,(H,8,9);;;/q;-3;2*+2/p-1 |
| InChIKey | TXFPRDTVXXTCAS-UHFFFAOYSA-M |
| XLogP | -3.90 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dizinc;benzoate;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dizinc;benzoate;borate?
The IUPAC name of dizinc;benzoate;borate (CID 19995354) is dizinc;benzoate;borate.
What is the SMILES notation for dizinc;benzoate;borate?
The canonical SMILES for dizinc;benzoate;borate is O=C([O-])c1ccccc1.[O-]B([O-])[O-].[Zn+2].[Zn+2].
What is the InChIKey of dizinc;benzoate;borate?
The InChIKey is TXFPRDTVXXTCAS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6O2.BO3.2Zn/c8-7(9)6-4-2-1-3-5-6;2-1(3)4;;/h1-5H,(H,8,9);;;/q;-3;2*+2/p-1.
What are the key properties of dizinc;benzoate;borate?
dizinc;benzoate;borate has a molecular weight of 310.70 g/mol, XLogP of -3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dizinc;benzoate;borate is sourced from PubChem (CID 19995354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).