C15H11F5O3S — CID 19995416
1-(2,3,4,5,6-pentafluorophenyl)ethyl 4-methylbenzenesulfonate (PubChem CID 19995416) has the molecular formula C15H11F5O3S and a molecular weight of 366.31 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 19995416 |
| Molecular Formula | C15H11F5O3S |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H11F5O3S/c1-7-3-5-9(6-4-7)24(21,22)23-8(2)10-11(16)13(18)15(20)14(19)12(10)17/h3-6,8H,1-2H3 |
| InChIKey | LCGQZLMSMOHIKL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|