About azane;N',N'-diethylpropane-1,3-diamine
azane;N',N'-diethylpropane-1,3-diamine (PubChem CID 19995440) has the molecular formula C7H21N3
and a molecular weight of 147.27 g/mol. Its IUPAC name is azane;N',N'-diethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | azane;N',N'-diethylpropane-1,3-diamine |
| PubChem CID | 19995440 |
| Molecular Formula | C7H21N3 |
| Molecular Weight | 147.27 g/mol |
| Exact Mass | 147.17 |
| IUPAC Name | azane;N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN.N |
| InChI | InChI=1S/C7H18N2.H3N/c1-3-9(4-2)7-5-6-8;/h3-8H2,1-2H3;1H3 |
| InChIKey | PWXSMHJGYTYFHW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;N',N'-diethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N',N'-diethylpropane-1,3-diamine?
The IUPAC name of azane;N',N'-diethylpropane-1,3-diamine (CID 19995440) is azane;N',N'-diethylpropane-1,3-diamine.
What is the SMILES notation for azane;N',N'-diethylpropane-1,3-diamine?
The canonical SMILES for azane;N',N'-diethylpropane-1,3-diamine is CCN(CC)CCCN.N.
What is the InChIKey of azane;N',N'-diethylpropane-1,3-diamine?
The InChIKey is PWXSMHJGYTYFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2.H3N/c1-3-9(4-2)7-5-6-8;/h3-8H2,1-2H3;1H3.
What are the key properties of azane;N',N'-diethylpropane-1,3-diamine?
azane;N',N'-diethylpropane-1,3-diamine has a molecular weight of 147.27 g/mol, XLogP of 0.84, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N',N'-diethylpropane-1,3-diamine is sourced from PubChem (CID 19995440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).