C9H5ClF5NO — CID 19995461
(NZ)-N-[1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropylidene]hydroxylamine (PubChem CID 19995461) has the molecular formula C9H5ClF5NO and a molecular weight of 273.59 g/mol. Its IUPAC name is (NZ)-N-[1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropylidene]hydroxylamine |
|---|---|
| PubChem CID | 19995461 |
| Molecular Formula | C9H5ClF5NO |
| Molecular Weight | 273.59 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (NZ)-N-[1-(4-chlorophenyl)-2,2,3,3,3-pentafluoropropylidene]hydroxylamine |
| SMILES | O/N=C(/c1ccc(Cl)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5ClF5NO/c10-6-3-1-5(2-4-6)7(16-17)8(11,12)9(13,14)15/h1-4,17H/b16-7- |
| InChIKey | CYJBBMIRJFOEET-APSNUPSMSA-N |
| XLogP | 3.72 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|