About 3,10-dimethyl-5H-phenazine-2,7-diol
3,10-dimethyl-5H-phenazine-2,7-diol (PubChem CID 19996284) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is 3,10-dimethyl-5H-phenazine-2,7-diol.
Molecular Properties
| Compound Name | 3,10-dimethyl-5H-phenazine-2,7-diol |
| PubChem CID | 19996284 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 3,10-dimethyl-5H-phenazine-2,7-diol |
| SMILES | Cc1cc2c(cc1O)N(C)c1ccc(O)cc1N2 |
| InChI | InChI=1S/C14H14N2O2/c1-8-5-10-13(7-14(8)18)16(2)12-4-3-9(17)6-11(12)15-10/h3-7,15,17-18H,1-2H3 |
| InChIKey | TUOBEIDLHAUUFW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,10-dimethyl-5H-phenazine-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,10-dimethyl-5H-phenazine-2,7-diol?
The IUPAC name of 3,10-dimethyl-5H-phenazine-2,7-diol (CID 19996284) is 3,10-dimethyl-5H-phenazine-2,7-diol.
What is the SMILES notation for 3,10-dimethyl-5H-phenazine-2,7-diol?
The canonical SMILES for 3,10-dimethyl-5H-phenazine-2,7-diol is Cc1cc2c(cc1O)N(C)c1ccc(O)cc1N2.
What is the InChIKey of 3,10-dimethyl-5H-phenazine-2,7-diol?
The InChIKey is TUOBEIDLHAUUFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-8-5-10-13(7-14(8)18)16(2)12-4-3-9(17)6-11(12)15-10/h3-7,15,17-18H,1-2H3.
What are the key properties of 3,10-dimethyl-5H-phenazine-2,7-diol?
3,10-dimethyl-5H-phenazine-2,7-diol has a molecular weight of 242.28 g/mol, XLogP of 3.23, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,10-dimethyl-5H-phenazine-2,7-diol is sourced from PubChem (CID 19996284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).