About 6-propan-2-ylazuleno[1,2-b]furan
6-propan-2-ylazuleno[1,2-b]furan (PubChem CID 19996744) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 6-propan-2-ylazuleno[1,2-b]furan.
Molecular Properties
| Compound Name | 6-propan-2-ylazuleno[1,2-b]furan |
| PubChem CID | 19996744 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 6-propan-2-ylazuleno[1,2-b]furan |
| SMILES | CC(C)c1cccc2c3occc3cc-2c1 |
| InChI | InChI=1S/C15H14O/c1-10(2)11-4-3-5-14-13(8-11)9-12-6-7-16-15(12)14/h3-10H,1-2H3 |
| InChIKey | MIUOBXWBCFVIAF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-propan-2-ylazuleno[1,2-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylazuleno[1,2-b]furan?
The IUPAC name of 6-propan-2-ylazuleno[1,2-b]furan (CID 19996744) is 6-propan-2-ylazuleno[1,2-b]furan.
What is the SMILES notation for 6-propan-2-ylazuleno[1,2-b]furan?
The canonical SMILES for 6-propan-2-ylazuleno[1,2-b]furan is CC(C)c1cccc2c3occc3cc-2c1.
What is the InChIKey of 6-propan-2-ylazuleno[1,2-b]furan?
The InChIKey is MIUOBXWBCFVIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O/c1-10(2)11-4-3-5-14-13(8-11)9-12-6-7-16-15(12)14/h3-10H,1-2H3.
What are the key properties of 6-propan-2-ylazuleno[1,2-b]furan?
6-propan-2-ylazuleno[1,2-b]furan has a molecular weight of 210.28 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylazuleno[1,2-b]furan is sourced from PubChem (CID 19996744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).