C23H31N5O8S — CID 19999861
2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 19999861) has the molecular formula C23H31N5O8S and a molecular weight of 537.60 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19999861 |
| Molecular Formula | C23H31N5O8S |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | CSCCC(N)C(=O)NC(CO)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H31N5O8S/c1-37-7-6-14(24)20(32)28-18(11-29)22(34)26-16(21(33)27-17(23(35)36)9-19(30)31)8-12-10-25-15-5-3-2-4-13(12)15/h2-5,10,14,16-18,25,29H,6-9,11,24H2,1H3,(H,26,34)(H,27,33)(H,28,32)(H,30,31)(H,35,36) |
| InChIKey | YQVAQFWNABXIGK-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |