About 2-benzylpyridine
2-benzylpyridine (PubChem CID 7581) has the molecular formula C12H11N
and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-benzylpyridine.
Molecular Properties
| Compound Name | 2-benzylpyridine |
| PubChem CID | 7581 |
| Molecular Formula | C12H11N |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-benzylpyridine |
| SMILES | c1ccc(Cc2ccccn2)cc1 |
| InChI | InChI=1S/C12H11N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-9H,10H2 |
| InChIKey | PCFUWBOSXMKGIP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylpyridine?
The IUPAC name of 2-benzylpyridine (CID 7581) is 2-benzylpyridine.
What is the SMILES notation for 2-benzylpyridine?
The canonical SMILES for 2-benzylpyridine is c1ccc(Cc2ccccn2)cc1.
What is the InChIKey of 2-benzylpyridine?
The InChIKey is PCFUWBOSXMKGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N/c1-2-6-11(7-3-1)10-12-8-4-5-9-13-12/h1-9H,10H2.
What are the key properties of 2-benzylpyridine?
2-benzylpyridine has a molecular weight of 169.23 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylpyridine is sourced from PubChem (CID 7581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).