About 2-ethoxybenzamide
2-ethoxybenzamide (PubChem CID 3282) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-ethoxybenzamide.
Molecular Properties
| Compound Name | 2-ethoxybenzamide |
| PubChem CID | 3282 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(N)=O |
| InChI | InChI=1S/C9H11NO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
| InChIKey | SBNKFTQSBPKMBZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybenzamide?
The IUPAC name of 2-ethoxybenzamide (CID 3282) is 2-ethoxybenzamide.
What is the SMILES notation for 2-ethoxybenzamide?
The canonical SMILES for 2-ethoxybenzamide is CCOc1ccccc1C(N)=O.
What is the InChIKey of 2-ethoxybenzamide?
The InChIKey is SBNKFTQSBPKMBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H2,10,11).
What are the key properties of 2-ethoxybenzamide?
2-ethoxybenzamide has a molecular weight of 165.19 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybenzamide is sourced from PubChem (CID 3282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).