About 2-methoxypropane
2-methoxypropane (PubChem CID 11721) has the molecular formula C4H10O
and a molecular weight of 74.12 g/mol. Its IUPAC name is 2-methoxypropane.
Molecular Properties
| Compound Name | 2-methoxypropane |
| PubChem CID | 11721 |
| Molecular Formula | C4H10O |
| Molecular Weight | 74.12 g/mol |
| Exact Mass | 74.07 |
| IUPAC Name | 2-methoxypropane |
| SMILES | COC(C)C |
| InChI | InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3 |
| InChIKey | RMGHERXMTMUMMV-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 74.12 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypropane?
The IUPAC name of 2-methoxypropane (CID 11721) is 2-methoxypropane.
What is the SMILES notation for 2-methoxypropane?
The canonical SMILES for 2-methoxypropane is COC(C)C.
What is the InChIKey of 2-methoxypropane?
The InChIKey is RMGHERXMTMUMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O/c1-4(2)5-3/h4H,1-3H3.
What are the key properties of 2-methoxypropane?
2-methoxypropane has a molecular weight of 74.12 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypropane is sourced from PubChem (CID 11721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).