About 2-phenoxyquinoxaline
2-phenoxyquinoxaline (PubChem CID 3734282) has the molecular formula C14H10N2O
and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-phenoxyquinoxaline.
Molecular Properties
| Compound Name | 2-phenoxyquinoxaline |
| PubChem CID | 3734282 |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-phenoxyquinoxaline |
| SMILES | c1ccc(Oc2cnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C14H10N2O/c1-2-6-11(7-3-1)17-14-10-15-12-8-4-5-9-13(12)16-14/h1-10H |
| InChIKey | BSDZLWKEACOABU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxyquinoxaline?
The IUPAC name of 2-phenoxyquinoxaline (CID 3734282) is 2-phenoxyquinoxaline.
What is the SMILES notation for 2-phenoxyquinoxaline?
The canonical SMILES for 2-phenoxyquinoxaline is c1ccc(Oc2cnc3ccccc3n2)cc1.
What is the InChIKey of 2-phenoxyquinoxaline?
The InChIKey is BSDZLWKEACOABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O/c1-2-6-11(7-3-1)17-14-10-15-12-8-4-5-9-13(12)16-14/h1-10H.
What are the key properties of 2-phenoxyquinoxaline?
2-phenoxyquinoxaline has a molecular weight of 222.25 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxyquinoxaline is sourced from PubChem (CID 3734282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).