C24H20ClN3O6S — CID 2000032
(1S)-7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3,4,5-trimethoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 2000032) has the molecular formula C24H20ClN3O6S and a molecular weight of 513.96 g/mol. Its IUPAC name is (1S)-7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3,4,5-trimethoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | (1S)-7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3,4,5-trimethoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 2000032 |
| Molecular Formula | C24H20ClN3O6S |
| Molecular Weight | 513.96 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (1S)-7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3,4,5-trimethoxyphenyl)-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1nnc(N2C(=O)c3oc4ccc(Cl)cc4c(=O)c3[C@@H]2c2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C24H20ClN3O6S/c1-5-17-26-27-24(35-17)28-19(11-8-15(31-2)21(33-4)16(9-11)32-3)18-20(29)13-10-12(25)6-7-14(13)34-22(18)23(28)30/h6-10,19H,5H2,1-4H3/t19-/m0/s1 |
| InChIKey | HCIXOYBAAKMVSB-IBGZPJMESA-N |
| XLogP | 4.64 |
| TPSA | 103.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.96 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |