C18H17N3O3S — CID 2000798
N-[4-[[(5R)-3-(2-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]phenyl]acetamide (PubChem CID 2000798) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[4-[[(5R)-3-(2-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[(5R)-3-(2-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 2000798 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[4-[[(5R)-3-(2-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N[C@@H]2SC(=O)N(c3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C18H17N3O3S/c1-11-5-3-4-6-15(11)21-17(23)16(25-18(21)24)20-14-9-7-13(8-10-14)19-12(2)22/h3-10,16,20H,1-2H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | AEKCWNCNQDREFL-MRXNPFEDSA-N |
| XLogP | 3.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|